94248-99-4 Usage
Uses
Used in Pharmaceutical Industry:
6-methylpyridazin-3(2H)-one monohydrobromide is used as an intermediate in the synthesis of various pharmaceutical drugs due to its stable and water-soluble nature, facilitating the development of new medications with improved efficacy and safety profiles.
Used in Research Chemicals:
In the field of research, 6-methylpyridazin-3(2H)-one monohydrobromide serves as a valuable research chemical, enabling scientists to explore its potential applications and properties in various chemical and biological studies.
Used in Industrial Applications:
6-methylpyridazin-3(2H)-one monohydrobromide is utilized in certain industrial applications, where its stability and water solubility are beneficial for the production of specific chemical products or processes.
Check Digit Verification of cas no
The CAS Registry Mumber 94248-99-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,2,4 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 94248-99:
(7*9)+(6*4)+(5*2)+(4*4)+(3*8)+(2*9)+(1*9)=164
164 % 10 = 4
So 94248-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O.BrH/c1-4-2-3-5(8)7-6-4;/h2-3H,1H3,(H,7,8);1H
