942507-89-3 Usage
Uses
Used in Pharmaceutical Industry:
4-CHLOROQUINAZOLINE-7-CARBOXYLIC ACID is used as a key intermediate in the development of novel drugs for various therapeutic applications. Its unique chemical structure allows for the design and synthesis of new drug candidates with improved pharmacological properties.
Used in Organic Synthesis:
4-CHLOROQUINAZOLINE-7-CARBOXYLIC ACID serves as a valuable building block in organic synthesis, enabling the creation of a wide range of chemical compounds with diverse applications. Its versatile structure allows for various chemical reactions and modifications, facilitating the synthesis of complex organic molecules.
Used in Medicinal Chemistry Research:
4-CHLOROQUINAZOLINE-7-CARBOXYLIC ACID is utilized as a research tool in medicinal chemistry to explore its potential biological activities and pharmacological effects. Researchers can investigate its interactions with biological targets, such as enzymes, receptors, or other proteins, to understand its mechanism of action and optimize its therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 942507-89-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,2,5,0 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 942507-89:
(8*9)+(7*4)+(6*2)+(5*5)+(4*0)+(3*7)+(2*8)+(1*9)=183
183 % 10 = 3
So 942507-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H5ClN2O2/c10-8-6-2-1-5(9(13)14)3-7(6)11-4-12-8/h1-4H,(H,13,14)
942507-89-3Relevant academic research and scientific papers
CHEMICAL COMPOUNDS
-
Page/Page column 45, (2008/06/13)
The invention relates to chemical compounds of the formula (I) or pharmaceutically acceptable salts thereof, which possess B Raf inhibitory activity and are accordingly useful for their anti cancer activity and thus in methods of treatment of the human or animal body. The invention also relates to processes for the manufacture of said chemical compounds, to pharmaceutical compositions containing them and to their use in the manufacture of medicaments of use in the production of an anti-cancer effect in a warm blooded animal such as man.
