942519-63-3 Usage
Uses
Used in Pharmaceutical Industry:
[(3-ethylisoxazol-5-yl)methyl]methylamine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the isoxazole ring and the ethyl and methylamine substituents, may contribute to the development of new drugs with specific therapeutic targets.
Used in Chemical Research:
In the field of chemical research, [(3-ethylisoxazol-5-yl)methyl]methylamine serves as a valuable compound for studying the properties and reactions of aminoazoles. Its synthesis and modification can provide insights into the behavior of similar organic compounds and potentially lead to the discovery of new chemical reactions or applications.
Check Digit Verification of cas no
The CAS Registry Mumber 942519-63-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,2,5,1 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 942519-63:
(8*9)+(7*4)+(6*2)+(5*5)+(4*1)+(3*9)+(2*6)+(1*3)=183
183 % 10 = 3
So 942519-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O/c1-3-6-4-7(5-8-2)10-9-6/h4,8H,3,5H2,1-2H3
942519-63-3Relevant academic research and scientific papers
Reaction of 3-alkyl(aryl)-5-chloromethylisoxazoles with nucleophilic reagents
Gadzhily,Potkin,Aliev,Gadzhieva,Petkevich,Dikusar
experimental part, p. 1531 - 1534 (2012/03/09)
Previously unknown 3-alkyl(aryl)isoxazoles containing various functional groups in the 5-position were synthesized by reactions of 3-alkyl(aryl)-5- chloromethylisoxazoles with nucleophiles (2-aminoethanol, methylamine, sodium acetate, and sodium methoxide). Pleiades Publishing, Ltd., 2011.
