94602-04-7 Usage
Uses
Used in Organic Synthesis:
4-Ethoxy-3-nitropyridine hydrochloride is used as an intermediate in organic synthesis for the preparation of a wide range of organic compounds. Its presence of both ethoxy and nitro groups allows for various chemical reactions, such as nucleophilic substitution, reduction, and coupling reactions, making it a versatile building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Ethoxy-3-nitropyridine hydrochloride is used as a key intermediate in the synthesis of 3,4-diaminopyridine, which is an important compound with various biological activities. 3,4-Diaminopyridine has been found to have potential applications in the treatment of neurological disorders, such as multiple sclerosis, and as a therapeutic agent for various other conditions. The synthesis of 3,4-diaminopyridine typically involves the reduction of the nitro group in 4-Ethoxy-3-nitropyridine hydrochloride, followed by nucleophilic substitution of the ethoxy group.
Used in Research and Development:
4-Ethoxy-3-nitropyridine hydrochloride is also used in research and development for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique reactivity and functional groups make it an attractive candidate for studying reaction mechanisms, developing new synthetic methods, and discovering new compounds with potential applications in various fields, such as materials science, pharmaceuticals, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 94602-04-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,6,0 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 94602-04:
(7*9)+(6*4)+(5*6)+(4*0)+(3*2)+(2*0)+(1*4)=127
127 % 10 = 7
So 94602-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O3.ClH/c1-2-12-7-3-4-8-5-6(7)9(10)11;/h3-5H,2H2,1H3;1H
