94741-70-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Amino-2-bromopyrimidine-5-carbonitrile is used as a key intermediate in the synthesis of pyrimidine-based drugs for various therapeutic applications. Its unique structure allows for the development of compounds with specific biological activities, making it a crucial component in the creation of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Amino-2-bromopyrimidine-5-carbonitrile serves as an essential building block for the synthesis of agrochemicals with pesticidal or herbicidal properties. Its incorporation into these compounds can enhance their effectiveness in protecting crops and managing pests.
Used as an Enzyme and Receptor Inhibitor:
4-Amino-2-bromopyrimidine-5-carbonitrile is utilized in drug discovery and research as an inhibitor of certain enzymes and receptors. Its ability to modulate biological targets makes it a valuable tool for understanding disease mechanisms and developing targeted therapies.
Used in the Synthesis of Bioactive Compounds:
4-Amino-2-bromopyrimidine-5-carbonitrile is employed as a precursor in the synthesis of bioactive compounds, which have potential applications in various fields such as medicine, agriculture, and materials science. Its versatility in chemical reactions enables the creation of a wide range of functional materials with specific properties.
Overall, 4-Amino-2-bromopyrimidine-5-carbonitrile plays a significant role in the development of new pharmaceuticals, agrochemicals, and other bioactive compounds, making it an indispensable component in the fields of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 94741-70-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,7,4 and 1 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 94741-70:
(7*9)+(6*4)+(5*7)+(4*4)+(3*1)+(2*7)+(1*0)=155
155 % 10 = 5
So 94741-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrN4/c6-5-9-2-3(1-7)4(8)10-5/h2H,(H2,8,9,10)
94741-70-5Relevant academic research and scientific papers
A Convenient Synthesis of 2-Substituted 4-Amino-5-pyrimidinecarbonitriles
Schmidt, Hans-Werner,Koitz, Gerald,Junek, Hans
, p. 1305 - 1307 (2007/10/02)
Synthesis of the novel 2-halogenated 4-amino-5-pyrimidinecarbonitriles 3a,b starting from ethoxymethylenemalononitrile 1 and cyanamide is described.Nucleophilic substitution of the reactive halogen atom leads to the derivatives 5a-g,6 and 7a-h.
