949922-44-5 Usage
Uses
Used in Pharmaceutical Synthesis:
1,7-NAPHTHYRIDINE-3-CARBOXYLATE is used as a key intermediate in the synthesis of pharmaceuticals for its potential biological activities. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to advancements in medicinal chemistry.
Used in Agrochemical Production:
In the agrochemical industry, 1,7-NAPHTHYRIDINE-3-CARBOXYLATE serves as a crucial component in the creation of pesticides and other agricultural chemicals. Its incorporation enhances the effectiveness of these products, promoting more efficient and targeted pest control solutions.
Used as a Building Block for Heterocyclic Compounds:
1,7-NAPHTHYRIDINE-3-CARBOXYLATE is utilized as a building block in the preparation of various heterocyclic compounds. Its structural properties make it a valuable precursor for the synthesis of complex organic molecules, which have applications in a wide range of chemical and material sciences.
Used in Research and Development:
1,7-NAPHTHYRIDINE-3-CARBOXYLATE is employed in research and development settings to explore its potential applications and properties. Its unique chemical structure offers opportunities for the discovery of new reactions and the creation of novel compounds, further expanding the horizons of chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 949922-44-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,9,9,2 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 949922-44:
(8*9)+(7*4)+(6*9)+(5*9)+(4*2)+(3*2)+(2*4)+(1*4)=225
225 % 10 = 5
So 949922-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-2-15-11(14)9-5-8-3-4-12-7-10(8)13-6-9/h3-7H,2H2,1H3
949922-44-5Relevant academic research and scientific papers
Chan, Laval,Jin, Haolun,Stefanac, Tomislav,Wang, Wei,Lavallee, Jean-Francois,Bedard, Jean,May, Suzanne
, p. 2583 - 2586 (1999)
Structure-activity relationship studies on our newly identified anti-HCMV compounds, the 1,6-naphthyridines led to the identification of isoquinoline-6-carboxamides as potent and selective anti-HCMV agents.
