95046-30-3 Usage
Uses
Used in Pharmaceutical Industry:
N-[3-methyl-5-[(phenylmethyl)thio]-1,3,4-thiadiazol-2(3H)-ylidene]acetamide is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
N-[3-methyl-5-[(phenylmethyl)thio]-1,3,4-thiadiazol-2(3H)-ylidene]acetamide is also used in chemical research for the study of its reactivity and properties. It can be employed in the development of new synthetic methods and the exploration of its potential applications in various chemical reactions.
Used in Antimicrobial Agents:
N-[3-methyl-5-[(phenylmethyl)thio]-1,3,4-thiadiazol-2(3H)-ylidene]acetamide is used in the preparation of ((benzylsulfinyl)methyl-1,3,4-thiadiazolylidene)-thiourea/urea derivatives, which exhibit antibacterial and antifungal activities. These derivatives have potential applications in the development of new antimicrobial agents to combat drug-resistant infections.
Check Digit Verification of cas no
The CAS Registry Mumber 95046-30-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,0,4 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 95046-30:
(7*9)+(6*5)+(5*0)+(4*4)+(3*6)+(2*3)+(1*0)=133
133 % 10 = 3
So 95046-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3OS2/c1-9(16)13-11-15(2)14-12(18-11)17-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/b13-11-
