96017-10-6 Usage
Uses
Used in Pharmaceutical Industry:
2-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid is used as a pharmaceutical compound for its potential bioactivity. Its unique molecular structure allows it to interact with biological targets, making it a candidate for the development of new drugs with specific therapeutic effects.
Used in Dye Industry:
In the dye industry, 2-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid is used as a colorant due to its ability to absorb and reflect specific wavelengths of light. Its unique molecular structure contributes to its color properties, making it a valuable component in the creation of various dyes and pigments.
Used in Organic Semiconductors:
2-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid is utilized as an organic semiconductor due to its electronic properties. Its molecular structure allows for charge transport and conductivity, making it a promising material for use in organic electronic devices such as solar cells, transistors, and light-emitting diodes.
Used in Photoinitiators for Polymerization Reactions:
In the field of polymer chemistry, 2-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid serves as a photoinitiator for polymerization reactions. Its ability to absorb light and generate reactive species upon exposure enables the initiation of polymerization processes, making it a valuable component in the synthesis of various polymer materials.
Overall, the diverse applications of 2-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid highlight its potential as a versatile compound with significant implications in various industries. Its unique molecular structure and properties make it a promising candidate for further research and development to unlock its full potential.
Check Digit Verification of cas no
The CAS Registry Mumber 96017-10-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,0,1 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 96017-10:
(7*9)+(6*6)+(5*0)+(4*1)+(3*7)+(2*1)+(1*0)=126
126 % 10 = 6
So 96017-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H15NO3/c19-16-14-9-5-4-8-13(14)11-18(16)15(17(20)21)10-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,20,21)/p-1/t15-/m1/s1
96017-10-6Relevant academic research and scientific papers
Cyclic amides
-
, (2008/06/13)
Cyclic amides are inhibitors of tumor necrosis factor and can be used to combat cachexia, endotoxic shock, and retrovirus replication. A typical embodiment is 3-phenyl-3-(1-oxoisoindolin-2-yl)propionamide.
Reactions of boroxazolidones with aromatic aldehydes. An easy route to derivatives of isoquinoline and iso-indolinone
Nefkens,Zwanenburg
, p. 6063 - 6066 (2007/10/02)
Boroxazolidones 1 derived from glycine and phenylalanine react with aromatic aldehydes to form the corresponding imines. The product 3 from 1a with o-carboxybenzaldehyde is converted into 4-hydroxyisoquinoline-3-carboxylic acid 6 by dimethyl sulfate, foll
A Simple One-step Synthesis of N-Substituted Isoindolin-1-ones. Diastereofacially Selective Protonation of an Intermediate Isoindolinol
Grigg, Ronald,Gunaratne, H. Q. Nimal,Sridharan, Visuvanathar
, p. 1183 - 1184 (2007/10/02)
α-Amino acids and their methyl esters, arylamines, heterocyclic amines and, less efficiently, aryl substituted aliphatic amines, react with o-phthaldialdehyde in the presence of acetic acid to give N-substituted isoindolin-1-ones in excellent yield; deute
Synthesis of the 5H-Pyrroloisoindole Ring with 1,3-Dipolar Cycloaddition Reactions
New, J. S.,Yevich, J. P.
, p. 1355 - 1360 (2007/10/02)
The 1,3-dipolar cycloaddition reaction between mesoionic oxazolines, formed from either 1,3-dihydro-2-substituted-2H-isoindole-1-carboxylic acids or 1,3-dihydro-1-oxo-α-substituted-2H-isoindole-2-acetic acids, and dimethylacetylene dicarboxylate has led t