960371-08-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoropyridine-2-acetonitrile is used as a key intermediate in the synthesis of various drug molecules. Its unique structure and reactivity allow for the development of new pharmaceutical compounds with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
5-Fluoropyridine-2-acetonitrile is utilized as a starting material in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in crop protection and contribute to more sustainable agricultural practices.
Used in Organic Chemistry Research:
As a fluorinated pyridine derivative, 5-Fluoropyridine-2-acetonitrile is employed in various research applications within the field of organic chemistry. Its unique properties make it a valuable tool for exploring new chemical reactions and developing innovative synthetic pathways.
Used in the Synthesis of Advanced Materials:
5-Fluoropyridine-2-acetonitrile's unique chemical structure also makes it a promising candidate for the development of advanced materials with specific properties, such as high thermal stability, electrical conductivity, or catalytic activity. These materials can find applications in various industries, including electronics, energy, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 960371-08-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,6,0,3,7 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 960371-08:
(8*9)+(7*6)+(6*0)+(5*3)+(4*7)+(3*1)+(2*0)+(1*8)=168
168 % 10 = 8
So 960371-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN2/c8-6-1-2-7(3-4-9)10-5-6/h1-2,5H,3H2
960371-08-8Relevant articles and documents
Benzamide derivatives and uses related thereto
-
Page/Page column 65-66, (2008/06/13)
Benzamide derivatives of formula I are described and have therapeutic utility, particularly in the treatment of diabetes, obesity and related conditions and disorders: wherein R1, R2, R3, R4, R5, R6, R7, R8, and n are as defined herein.
