96612-95-2 Usage
Uses
Used in Pharmaceutical Synthesis:
Thiomorpholine-3-carboxylic acid hydrochloride is used as a building block for the synthesis of various pharmaceuticals and organic compounds. Its ability to form coordination compounds through chelating properties makes it a versatile component in the development of new drugs and medical substances.
Used in Coordination Compound Synthesis:
In the field of coordination chemistry, Thiomorpholine-3-carboxylic acid hydrochloride is used as a chelating agent for the synthesis of coordination compounds. Its capacity to bind with metal ions enhances the stability and reactivity of these compounds, which is crucial in various chemical and pharmaceutical applications.
Used in Drug Production:
Thiomorpholine-3-carboxylic acid hydrochloride is employed in the production of various drugs and medical substances. Its role as a key intermediate in the synthesis process allows for the creation of a wide range of therapeutic agents, contributing to advancements in medicinal chemistry and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 96612-95-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,6,1 and 2 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 96612-95:
(7*9)+(6*6)+(5*6)+(4*1)+(3*2)+(2*9)+(1*5)=162
162 % 10 = 2
So 96612-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2S.ClH/c7-5(8)4-3-9-2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H
