96612-95-2 Usage
General Description
Thiomorpholine-3-carboxylic acid hydrochloride is a chemical compound used in the synthesis of pharmaceuticals and organic compounds. It is a derivative of thiomorpholine, a heterocyclic organic compound, and is typically found as a white to off-white crystalline powder. This chemical is known for its ability to act as a chelating agent, which makes it useful in the synthesis of coordination compounds. Thiomorpholine-3-carboxylic acid hydrochloride is also used in the production of various drugs and medical substances, due to its potential as a building block for diverse chemical structures.
Check Digit Verification of cas no
The CAS Registry Mumber 96612-95-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,6,1 and 2 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 96612-95:
(7*9)+(6*6)+(5*6)+(4*1)+(3*2)+(2*9)+(1*5)=162
162 % 10 = 2
So 96612-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2S.ClH/c7-5(8)4-3-9-2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H
