98334-40-8 Usage
Chemical structure
Pyridinone derivative with a methyl group and an amino group attached to the pyridine ring
Applications
a. Synthesis of pharmaceuticals and agrochemicals
b. Antimicrobial and antifungal properties
c. Potential treatment for diseases and disorders (e.g., cancer, neurodegenerative diseases)
d. Building block for novel organic compounds
Chemical stability
Stable under normal conditions
Solubility
Soluble in polar solvents (e.g., water, methanol)
Reactivity
Reacts with various reagents for the synthesis of different compounds
Purity
Can be synthesized with high purity for research and industrial applications
Safety
Handle with care due to potential toxicity and reactivity with other chemicals
Research focus
a. Exploring its potential as a therapeutic agent for various diseases
b. Investigating its role in the synthesis of novel organic compounds
c. Evaluating its antimicrobial and antifungal properties for potential applications in medicine and agriculture
d. Studying its chemical properties and reactivity to optimize its use in various industries
Check Digit Verification of cas no
The CAS Registry Mumber 98334-40-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,3,3 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 98334-40:
(7*9)+(6*8)+(5*3)+(4*3)+(3*4)+(2*4)+(1*0)=158
158 % 10 = 8
So 98334-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-5-3-6(2)9(8)7(10)4-5/h3-4H,8H2,1-2H3
