98334-58-8 Usage
Uses
Used in Pharmaceutical Industry:
3-(Furan-2-Yl)Propanehydrazide is used as a key intermediate in the synthesis of pharmaceuticals for its ability to form various bioactive compounds. Its hydrazide group allows for the creation of a wide range of drug candidates, which can be further optimized for specific therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical field, 3-(Furan-2-Yl)Propanehydrazide is utilized as a precursor in the development of agrochemicals. Its unique structure and potential biological activities make it a valuable component in the design and synthesis of new pesticides, herbicides, and other agrochemical products.
Used in Research and Development:
3-(Furan-2-Yl)Propanehydrazide is employed in research and development for the exploration of its synthesis and biological activities. Studies on 3-(Furan-2-Yl)Propanehydrazide can provide valuable insights into the development of new drugs and agrochemicals, potentially leading to innovative solutions in both the medical and agricultural sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 98334-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,3,3 and 4 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 98334-58:
(7*9)+(6*8)+(5*3)+(4*3)+(3*4)+(2*5)+(1*8)=168
168 % 10 = 8
So 98334-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c8-9-7(10)4-3-6-2-1-5-11-6/h1-2,5H,3-4,8H2,(H,9,10)
