- CAS Number
- Product Names
- Molecular Formula
| 868-81-5 | Chlorodimethoxyborane | C2H6BClO2 |
| 1390-72-3 | catalpin | C16H18 O7 |
| 36901-84-5 | CIS,CIS-2,7-NONADIENE | C9H16 |
| 136004-14-3 | cyclo(5-hydroxytryptophyl-5-hydroxytryptophyl) | C22H20 N4 O4 |
| 12234-80-9 | C.I. Acid Brown 304(8CI,9CI) |
| 275-54-7 | Cyclopent[c]azepine | C9H7 N |
| 11068-66-9 | Copper alloy, base,(Nickel silver) |
| 2254-36-6 | Calligonine | C12H14 N2 |
| 9047-57-8 | CHONDROITIN AC LYASE |
| 97233-06-2 | Cinnamtannin D1 |
| 15304-39-9 | Cobalt(1+),bis(1,2-ethanediamine-N,N')difluoro-, iodide, (OC-6-22)- (9CI) | C4H16 Co F2 N4 . I |
| 14040-32-5 | CIS-DICHLOROBIS(ETHYLENEDIAMINE) | C4H16Cl3CoN4 |
| 117778-57-1 | colabomycin A | C30H30 N2 O7 |
| 162774-57-4 | C.I. Azoic Blue 6:1(9CI) |
| 1300-41-0 | CALCIUM PHENOLSULFONATE | C12H10CaO8S2 |
| 102499-76-3 | Copper, diaquabis(a-oxo-2-thiopheneacetato)-,(OC-6-12)- (9CI) | C12H10 Cu O8 S2 |
| 152143-10-7 | Carboxylic acids, C6-18and C8-15-di-, polymers with adipic acid, glutaric acid, propylene glycol andsuccinic acid |
| 123914-49-8 | cassiaside | C20H20O9 |
| 202189-52-4 | Conrauinone C |
| 111722-74-8 | Cyclosporin A,5-(N-methyl-L-leucine)- (9CI) | C63H113 N11 O12 |
| 51566-62-2 | Citronellyl nitrile | C10H17N |
| 77060-24-3 | cyclo(3,4-didehydroprolyl-4-chlorophenylalanyl-tryptophyl-seryl-tyrosyl-tryptophyl-N-methylleucyl-arginyl-prolyl-beta-alanyl) | C69H84 Cl N15 O12 |
| 152645-54-0 | Cyclodeca[b]furan-2(3H)-one,3a,4,7,8,9,10,11,11a-octahydro-4,9-dihydroxy-3-(methoxymethyl)-6-methyl-10-methylene-,(3S,3aS,4R,5E,9R,11aS)- | C16H24 O5 |
| 66867-30-9 | cyano(4-nitrophenyl)methyl methyl carbonate | C10H8N2O5 |
| 15723-28-1 | Chromium, ion (Cr4+) | Cr |
| 18530-02-4 | Campherenone |
| 156430-20-5 | Cyclo(L-alanylglycyl-L-prolyl-L-tyrosyl-L-leucyl) | C25H35 N5 O6 |
| 148152-07-2 | Carbonimidothioic acid,[[4-[(6-deoxy-a-L-mannopyranosyl)oxy]phenyl]methyl]-,O-methyl ester, [C(E)]- (9CI) | C15H21 N O6 S |
| 85967-04-0 | Cliviahaksine |
| 55956-47-3 | Cotylenin C | C33H52O11 |
| 55306-09-7 | Chromazol KS Benzoic acid, 3-[(1,8-dihydroxy-3,6-disulfo-2-naphthalenyl)azo]-2-hydroxy-5-sulfo-, trisodium salt |
| 8003-55-2 | C.I. Direct Brown 26 | C39H27N7O9S2.3Na |
| 41484-50-8 | cholest-5-en-3beta-yl p-ethoxybenzoate | C36H54 O3 |
| 72765-47-0 | Chromate(7-), bis[4-hydroxy-3-[(2-hydroxy- 5-nitro-3-sulfophenyl)azo]-6-[(3-sulfophenyl)amino ]-2-naphthalenesulfonato(5-)]-, heptasodium | C44H22 Cr N8 O26 S6 . 7 Na |
| 9050-75-3 | Cortropin Z | C207H309N56O59SZn+ |
| 204772-22-5 | Cyclopropaneacetic acid,1-[[[(1R)-1-[3-[(1E)-2-(7-chloro-2- quinolinyl)ethenyl]phenyl]-3-[3-methyl-5-[3- (trifluoromethyl)-3H-diazirin-3-yl]phenyl]- propyl]thio]methyl]- |
| 195970-78-6 | Cyclo[L-alanyl-3-amino-5-[(1-oxohexadecyl)- amino]benzoyl-L-alanyl-3-amino-5-[(1- oxohexadecyl)amino]benzoyl-L-alanyl-3- amino-5-[(1-oxohexadecyl)amino]benzoyl-Lalanyl- 3-amino-5-[(1-oxohexadecyl)amino]- benzoyl] |
| 72986-44-8 | Castor oil, ethoxylated propoxylated |
| 5548-55-0 | cellotetraitol | C24H44 O21 |
| 212757-10-3 | CIS-2-(2-THIOPHENECARBONYL)-1-CYCLOHEXANECARBOXYLIC ACID, 99 | C12H14 O3 S |
| 83666-97-1 | Cluster admixed alloy |
| 1321-23-9 | chloroxylenol | C8H9ClO |
| 65583-10-0 | Chelope S |
| 3590-36-1 | Cytidine, 5-methyl-, 5'-(dihydrogen phosphate) (8CI) | C10H16N3O8P |
| 1678-81-5 | Cyclohexane,1,2,3-trimethyl-, (1a,2b,3a)- | C9H18 |
| 127350-69-0 | Cyclopenta[c][1]benzopyran-4(2H)-one,1,3,3a,5a,8,9,9a,9b-octahydro-3a,7,9b-trimethyl-, (3aR,5aR,9aS,9bR)-rel- (9CI) | C15H22 O2 |
| 68911-56-8 | Cyclohexanol, 4-(1,1-dimethylethyl)-, acetate, light distn. fractions | C12H22O2 |
| 125378-89-4 | Cobaltate(3-), bis[3-hydroxy-4-[(2-hydroxy- 1-naphthalenyl)azo]-7-nitro-1-naphthalenesulfonato (3-)]-, trisodium | C40H20 Co N6 O14 S2 . 3 Na |
| 118997-57-2 | C.I. Basic Yellow 92(9CI) |
| 436096-92-3 | CYCLOHEX-3-ENYLMETHYL-(3-MORPHOLIN-4-YL-PROPYL)-AMINE | C14H26 N2 O |
| 912-25-4 | cortisone sulfate | C21H28 O8 S |
| 19179-44-3 | copper dilaurate | C12H24 O2 . 1/2 Cu |
| 12144-85-3 | Cobalt, tricarbonyl(h3-2-propenyl)- | C6H5 Co O3 |
| 127620-12-6 | carbanide, diethoxy-methyl-phosphanium, platinum(+2) cation | C12H32 O4 P2 Pt |
| 1235-30-9 | chloro[tris(4-chlorophenyl)]stannane | C18H12 Cl4 Sn |
| 562-09-4 | CHLORPHENOXAMINE HYDROCHLORIDE (200 MG) | C18H22 Cl N O . Cl H |
| 81541-05-1 | cecropin A (1-33) | C128H216N36O32 |
| 157184-36-6 | Cepacidine A | C52H85 N11 O22 |
| 11105-90-1 | cyclopentylcyclopentane, iron | C20H16 Fe2 |
| 99780-73-1 | carbamylated triiodothyronine | C22H17 I3 N2 O5 |
| 164383-18-0 | Cyclohexanamine, N,N-dimethyl-, compd. with .alpha.-isotridecyl-.omega.-hydroxypoly(oxy-1,2-ethanediyl) phosphate | C8H17N.x(C2H4O)nC13H28O.xH3O4P |
| 135447-56-2 | cycloleonurinin | C65H85 N13 O18 |
| 28360-37-4 | Cobalt,tetracarbonylgermyl- | C4H3 Co Ge O4 |
| 1257-13-2 | cyclohexane-1,4-diylbis[N-(2,3-dimethoxybenzyl)methanamine] dihydrochloride | C26H38 N2 O4 . 2 Cl H |
| 7721-15-5 | CUPRIC LINOLEATE | C36H62CuO4 |
| 117698-11-0 | CELLOBIOSE QUINONE OXIDOREDUCTASE FROMWHITE MOULD* |
| 14017-41-5 | COBALT (II) SULFAMATE | Co.2(H2NO3S) |
| 25740-24-3 | Carbonochloridimidothioicacid, anhydrosulfide with thiohypochlorous acid (9CI) | CH Cl2 N S |
| 4474-39-9 | Carbamic acid,(aminosulfonyl)- |
| 12134-19-9 | Chromium silicide(Cr3Si2) | Cr |
| 72845-62-6 | Chromate(3-), bis(3-hydroxy-4-((4,5-dihydro-3-methyl-1-phenyl-1H-pyrazol-5-oxo-4-yl)azo)-7-nitronaphthalenesulfonato(3-))-, trihydrogen | C40H24CrN10O14S2.3H |
| 94386-63-7 | cis-3-vinylcyclohexyl acetate | C10H16 O2 |
| 29890-29-7 | Chromate(5-),bis[7-[[4-chloro-6-[phenyl(sulfomethyl)amino]-1,3,5-triazin-2-yl]amino]-3-(hydroxy-kO)-4-[[2-(hydroxy-kO)-1-naphthalenyl]azo-kN1]-1-naphthalenesulfonato(4-)]-,tetrasodium hydrogen (9CI) | C60H36 Cl2 Cr N14 O16 S4 . H . 4 Na |
| 12053-18-8 | COPPER CHROMITE | Cr2Cu2O5 |
| 14949-60-1 | Cadmium,bis(dimethylcarbamodithioato-kS,kS')-, (T-4)- (9CI) | C6H12 Cd N2 S4 |
| 13478-41-6 | copper(1+) fluoride | CuF |
| 11065-43-3 | Calciate(2-),[[N,N'-(oxydi-2,1-ethanediyl)bis[N-[(carboxy-kO)methyl]glycinato-kN,kO]](4-)]-, disodium (9CI) | C12H16 Ca N2 O9 . 2 Na |
| 14518-26-4 | Cobaltate(3-),hexakis(cyano-kC)-,copper(2+) (2:3), (OC-6-11)- (9CI) | C6Co N6 . 3/2 Cu |
| 87321-19-5 | CM 14 | C24H38O4 |
| 19908-69-1 | Confertin | C15H20O3 |
| 17091-31-5 | CAPROLACTAM MAGNESIUM BROMIDE | C6H10BrMgNO |
| 27373-90-6 | Cyclohexanol,3-methyl-2-(1-methylethyl)-, (1R,2S,3R)-rel-(-)- | C10H20 O |
| 1482-93-5 | Cyclohexane,1,2,3,4,5,6-hexaethylidene- | C18H24 |
| 118716-59-9 | Cuprate(3-), [3-[[5-hydroxy-4-[[1-hydroxy- 6-(phenylamino)-3-sulfo-2-naphthalenyl]azo]-2 -methylphenyl]azo]-1,5-naphthalenedisulfonato(5-) ]-, tripotassium | C33H20 Cu N5 O11 S3 . 3 K |
| 147652-23-1 | CIN8 protein |
| 85045-04-1 | Cordialin A | C30H46O5 |
| 24940-63-4 | calcium bis(hydrogen D-threo-hexo-2,5-diulosonate) | C6H8 O7 . 1/2 Ca |
| 2683-84-3 | chlorin | C20H16 N4 |
| 6297-47-8 | cyclopentyl 2-methylpentanoate | C11H20 O2 |
| 77464-89-2 | Contortrix |
| 1327-74-8 | C.I. Sulphur Green 2 |
| 196412-85-8 | Cellulose,esters,nitrate,mixt. with 2-methyl-1,3,5-trinitrobenzene |
| 148485-16-9 | chromium dinicotinate | C12H15 Cr N2 O8 |
| 168569-14-0 | Cyclo[(2R)-2-methyl-b-alanyl-(2S,3S)-2-hydroxy-3-methylpentanoyl-(2E,5S,6R,7E)-5-hydroxy-6-methyl-8-phenyl-2,7-octadienoyl-3-chloro-O-methyl-D-tyrosyl](9CI) | C35H43 Cl N2 O7 |
| 149346-56-5 | cab-m7 protein |
| 111618-82-7 | Cyclodeca[b]furan-2(3H)-one,9-(b-D-glucopyranosyloxy)-3a,4,5,8,9,11a-hexahydro-3,6,10-trimethyl-,(3S,3aS,6E,9S,10E,11aS)- | C21H32 O8 |
| 163362-99-0 | Calcitonin (Sardinopsmelanosticta reduced) (9CI) | C143H238 N44 O46 S2 |
| 205510-59-4 | C.I. Fluorescent Brightener 321 |
| 150348-92-8 | Carbamic acid,N-[(1S)-1-[[[(1S,2S,4R)-2-hydroxy-4-[4-(2-methyl-1-oxopropyl)-1H-imidazol-2-yl]-5-phenyl-1-(phenylmethyl)pentyl]amino]carbonyl]-2-methylpropyl]-,phenylmethyl ester | C38H46 N4 O5 |
| 6372-42-5 | Cyclohexyldiphenylphosphine | C18H21 P |
- About us - Payment - Contact us - Links - Help Center - Disclaimer
- SiteMap | Product SiteMap | New CAS | Cas Database | Article Data | Product Name | Chemical Catalog | Manufacturers | VIP Product | Suppliers
- ©2008 LookChem.com,License:ICP NO.lookchem:Zhejiang16009103 complaints:service@lookchem.com
- [Hangzhou]86-0571-87562588,87562578,87562573 Our Legal adviser: Lawyer