Uses

Used in Pharmaceutical Industry:
4-BROMO-ISOQUINOLINE-1-CARBONITRILE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-BROMO-ISOQUINOLINE-1-CARBONITRILE serves as an intermediate in the production of agrochemicals. Its incorporation into these compounds can contribute to the development of effective pesticides or other agricultural products.
Used in Organic Compounds Production:
4-BROMO-ISOQUINOLINE-1-CARBONITRILE is utilized in the synthesis of other organic compounds, expanding its applications across various chemical domains. Its versatility as a building block facilitates the creation of a wide range of molecules for different purposes.
Used in Chemical Reactions as a Building Block:
As a building block in chemical reactions, 4-BROMO-ISOQUINOLINE-1-CARBONITRILE enables the formation of complex molecules and contributes to the advancement of organic chemistry. Its presence in reactions can lead to the discovery of new compounds with unique properties and applications.

Check Digit Verification of cas no

The CAS Registry Mumber 27224-09-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,2 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 27224-09:
(7*2)+(6*7)+(5*2)+(4*2)+(3*4)+(2*0)+(1*9)=95
95 % 10 = 5
So 27224-09-5 is a valid CAS Registry Number.

InChI:InChI=1/C10H5BrN2/c11-9-6-13-10(5-12)8-4-2-1-3-7(8)9/h1-4,6H