Uses

Used in Pharmaceutical Synthesis:
4-Chloro-6-methylnicotinonitrile is employed as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs due to its unique chemical structure and properties.
Used in Agrochemical Production:
4-CHLORO-6-METHYLNICOTINONITRILE is also utilized in the production of agrochemicals, playing a crucial role in the creation of pesticides and other agricultural chemicals to enhance crop protection and yield.
Used in Organic Compounds Production:
4-Chloro-6-methylnicotinonitrile serves as a building block in the synthesis of other organic compounds, expanding its applications across various chemical industries.
Used in Research Applications:
Due to its unique characteristics, 4-Chloro-6-methylnicotinonitrile is commonly used in research settings to explore its properties and potential uses in chemical reactions and compound development.

Check Digit Verification of cas no

The CAS Registry Mumber 38875-76-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,8,7 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38875-76:
(7*3)+(6*8)+(5*8)+(4*7)+(3*5)+(2*7)+(1*6)=172
172 % 10 = 2
So 38875-76-2 is a valid CAS Registry Number.

InChI:InChI=1/C7H5ClN2/c1-5-2-7(8)6(3-9)4-10-5/h2,4H,1H3