Uses

Used in Chemical Research and Manufacturing:
Benzeneacetonitrile, 4-fluoro-2-methyl(9CI) is employed as a key intermediate in the synthesis of various chemical compounds. Its unique structure allows for versatile reactions and modifications, making it a valuable component in the development of new materials and products.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, Benzeneacetonitrile, 4-fluoro-2-methyl(9CI) is used as an intermediate for the production of various drugs. Its presence in the molecular structure can impart specific properties to the final product, such as enhanced solubility, stability, or bioavailability.
Used in Agrochemical Synthesis:
Similarly, in the agrochemical sector, Benzeneacetonitrile, 4-fluoro-2-methyl(9CI) serves as an intermediate in the synthesis of pesticides, herbicides, and other crop protection agents. Its incorporation into these compounds can contribute to improved efficacy, selectivity, or environmental safety.
Safety Precautions:

Check Digit Verification of cas no

The CAS Registry Mumber 80141-93-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,1,4 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80141-93:
(7*8)+(6*0)+(5*1)+(4*4)+(3*1)+(2*9)+(1*3)=101
101 % 10 = 1
So 80141-93-1 is a valid CAS Registry Number.

InChI:InChI=1/C9H8FN/c1-7-6-9(10)3-2-8(7)4-5-11/h2-3,6H,4H2,1H3