The 1H-Indene-2-methanol,2-amino-2,3-dihydro-, with the CAS registry number 136834-85-0, is also known as S14-2803. This chemical's molecular formula is C₁₀H₁₃NO and molecular weight is 163.21632. Its IUPAC name is called (2-amino-1,3-dihydroinden-2-yl)methanol.

Physical properties of 1H-Indene-2-methanol,2-amino-2,3-dihydro-: (1)ACD/LogP: 1.60 ; (2)ACD/LogD (pH 7.4): 0.29; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 8.69; (7)#H bond acceptors: 2; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 3; (10)Index of Refraction: 1.587; (11)Molar Refractivity: 48.11 cm³; (12)Molar Volume: 143 cm³; (13)Surface Tension: 54.4 dyne/cm; (14)Density: 1.14 g/cm³; (15)Flash Point: 132.9 °C; (16)Enthalpy of Vaporization: 56.59 kJ/mol; (17)Boiling Point: 296.1 °C at 760 mmHg; (18)Vapour Pressure: 0.000663 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C2=CC=CC=C2CC1(CO)N
(2)InChI: InChI=1S/C10H13NO/c11-10(7-12)5-8-3-1-2-4-9(8)6-10/h1-4,12H,5-7,11H2
(3)InChIKey: KWGNCGJHXQVIOE-UHFFFAOYSA-N