The CAS registry number of 1H-Indene-2-methanol is 18096-68-9. This chemical's molecular formula is C₁₀H₁₀O and molecular weight is 146.1858. Its systematic name is called 1H-inden-2-ylmethanol.

Physical properties of 1H-Indene-2-methanol: (1)ACD/LogP: 3.18; (2)ACD/LogD (pH 5.5): 3.18; (3)ACD/LogD (pH 7.4): 3.18; (4)ACD/BCF (pH 5.5): 154.35; (5)ACD/BCF (pH 7.4): 154.35; (6)ACD/KOC (pH 5.5): 1282.77; (7)ACD/KOC (pH 7.4): 1282.77; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.605; (12)Molar Refractivity: 44.25 cm³; (13)Molar Volume: 128.3 cm³; (14)Surface Tension: 45.5 dyne/cm; (15)Density: 1.138 g/cm³; (16)Flash Point: 139 °C; (17)Enthalpy of Vaporization: 55.58 kJ/mol; (18)Boiling Point: 287.1 °C at 760 mmHg; (19)Vapour Pressure: 0.00118 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OCC\2=C\c1ccccc1C/2
(2)InChI: InChI=1/C10H10O/c11-7-8-5-9-3-1-2-4-10(9)6-8/h1-5,11H,6-7H2
(3)InChIKey: PHBJUSIBFHGBPC-UHFFFAOYAU