The 2,4-Dihydroxy-5-methoxybenzaldehyde, with the CAS registry number 51061-83-7, is also known as Benzaldehyde, 2,4-dihydroxy-5-methoxy-. This chemical's molecular formula is C₈H₈O₄ and molecular weight is 168.1467. Its systematic name is called 2,4-dihydroxy-5-methoxybenzaldehyde.

Physical properties of 2,4-Dihydroxy-5-methoxybenzaldehyde: (1)ACD/LogP: 1.08; (2)ACD/LogD (pH 5.5): 1.08; (3)ACD/LogD (pH 7.4): 0.84; (4)ACD/BCF (pH 5.5): 3.88; (5)ACD/BCF (pH 7.4): 2.24; (6)ACD/KOC (pH 5.5): 91.59; (7)ACD/KOC (pH 7.4): 52.91; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.63; (12)Molar Refractivity: 43.44 cm³; (13)Molar Volume: 121.9 cm³; (14)Surface Tension: 59.7 dyne/cm; (15)Density: 1.378 g/cm³; (16)Flash Point: 148.2 °C; (17)Enthalpy of Vaporization: 61.89 kJ/mol; (18)Boiling Point: 350.7 °C at 760 mmHg; (19)Vapour Pressure: 2.13E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=Cc1cc(OC)c(O)cc1O
(2)InChI: InChI=1/C8H8O4/c1-12-8-2-5(4-9)6(10)3-7(8)11/h2-4,10-11H,1H3
(3)InChIKey: ZFZAFNQYRZGWNK-UHFFFAOYAV