The 4-Chloro-1-methyl-1h-pyrrolo[2,3-b]pyridine has the CAS registry number 74420-05-6. This chemical's molecular formula is C₈H₇ClN₂ and molecular weight is 166.61. What's more, its systematic name is 4-chloro-1-methyl-1H-pyrrolo[2,3-b]pyridine. 

Physical properties of 4-Chloro-1-methyl-1h-pyrrolo[2,3-b]pyridine are: (1)ACD/LogP: 2.09; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 15; (6)ACD/BCF (pH 7.4): 16; (7)ACD/KOC (pH 5.5): 235; (8)ACD/KOC (pH 7.4): 248; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 17.82 Å²; (13)Index of Refraction: 1.633; (14)Molar Refractivity: 45.738 cm³; (15)Molar Volume: 128.124 cm³; (16)Polarizability: 18.132×10^-24 cm³; (17)Surface Tension: 43.395 dyne/cm; (18)Density: 1.3 g/cm³; (19)Flash Point: 119.822 °C; (20)Enthalpy of Vaporization: 49.228 kJ/mol; (21)Boiling Point: 274.514 °C at 760 mmHg; (22)Vapour Pressure: 0.009 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: Clc2ccnc1c2ccn1C
(2)InChI: InChI=1/C8H7ClN2/c1-11-5-3-6-7(9)2-4-10-8(6)11/h2-5H,1H3
(3)InChIKey: GYGRXUOVLHHEMC-UHFFFAOYAZ