The CAS registry number of 5-Chloroquinazoline is 7556-90-3. This chemical's molecular formula is C₈H₅ClN₂ and molecular weight is 164.5917. Its systematic name is called 5-chloroquinazoline.

Physical properties of 5-Chloroquinazoline: (1)ACD/LogP: 1.67; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 8; (5)ACD/BCF (pH 7.4): 8; (6)ACD/KOC (pH 5.5): 150; (7)ACD/KOC (pH 7.4): 152; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.663; (10)Molar Refractivity: 45.173 cm³; (11)Molar Volume: 121.948 cm³; (12)Surface Tension: 57.134 dyne/cm; (13)Density: 1.35 g/cm³; (14)Flash Point: 150.634 °C; (15)Enthalpy of Vaporization: 49.884 kJ/mol; (16)Boiling Point: 280.95 °C at 760 mmHg; (17)Vapour Pressure: 0.006 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cccc2ncncc12
(2)InChI: InChI=1/C8H5ClN2/c9-7-2-1-3-8-6(7)4-10-5-11-8/h1-5H
(3)InChIKey: BUYNQWWHXMVWEE-UHFFFAOYAA