The 8-Quinolinol, with the CAS registry number 153-77-5, is also known as (8-Hydroxy)quinoline. This chemical's molecular formula is C₉H₇NO and molecular weight is 145.158. Its systematic name is called quinolin-8-ol.

Physical properties of 8-Quinolinol: (1)ACD/LogP: 1.90; (2)ACD/LogD (pH 5.5): 0.774; (3)ACD/LogD (pH 7.4): 0.818; (4)ACD/BCF (pH 5.5): 1.225; (5)ACD/BCF (pH 7.4): 1.354; (6)ACD/KOC (pH 5.5): 19.248; (7)ACD/KOC (pH 7.4): 21.275; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.691; (12)Molar Refractivity: 44.068 cm³; (13)Molar Volume: 115.203 cm³; (14)Surface Tension: 59.731 dyne/cm; (15)Density: 1.26 g/cm³; (16)Flash Point: 143.07 °C; (17)Enthalpy of Vaporization: 52.536 kJ/mol; (18)Boiling Point: 266.999 °C at 760 mmHg; (19)Vapour Pressure: 0.005 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc2cccnc2c(c1)O
(2)InChI: InChI=1/C9H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H
(3)InChIKey: MCJGNVYPOGVAJF-UHFFFAOYAG