The CAS registry number of Benzoic acid, 2-ethyl-,hydrazide is 59635-98-2. This chemical's molecular formula is C₉H₁₂N₂O and molecular weight is 164.2. What's more, its systematic name is called 2-Ethylbenzohydrazide.

Physical properties about Benzoic acid, 2-ethyl-,hydrazide are: (1)ACD/LogP: 1.24; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.24; (4)ACD/LogD (pH 7.4): 1.24; (5)ACD/BCF (pH 5.5): 5.13; (6)ACD/BCF (pH 7.4): 5.14; (7)ACD/KOC (pH 5.5): 112.06; (8)ACD/KOC (pH 7.4): 112.33; (9)#H bond acceptors: 3; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 55.12 Å²; (13)Index of Refraction: 1.558; (14)Molar Refractivity: 48.32 cm³; (15)Molar Volume: 149.7 cm³; (16)Polarizability: 19.15×10^-24 cm³; (17)Surface Tension: 44.2 dyne/cm; (18)Density: 1.096 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: CCc1ccccc1C(=O)NN
(2) InChI: InChI=1/C9H12N2O/c1-2-7-5-3-4-6-8(7)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12)
(3) InChIKey: PRGOMJUDGZDSQZ-UHFFFAOYAO