The D-Leucine, D-alanyl-, with the CAS registry number 67392-69-2, is also known as DL-Alanyl-L-leucine. This chemical's molecular formula is C₉H₁₈N₂O₃ and molecular weight is 202.2508. Its systematic name is called L-alanyl-L-leucine. 

Physical properties of D-Leucine, D-alanyl-: (1)ACD/LogP: 0.25; (2)ACD/LogD (pH 5.5): -2.25; (3)ACD/LogD (pH 7.4): -2.32; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 6; (11)Index of Refraction: 1.485; (12)Molar Refractivity: 52.34 cm³; (13)Molar Volume: 182.4 cm³; (14)Surface Tension: 42.6 dyne/cm; (15)Density: 1.108 g/cm³; (16)Flash Point: 201.6 °C; (17)Enthalpy of Vaporization: 72.63 kJ/mol; (18)Boiling Point: 409.7 °C at 760 mmHg; (19)Vapour Pressure: 7.34E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(N[C@H](C(=O)O)CC(C)C)[C@@H](N)C
(2)InChI: InChI=1/C9H18N2O3/c1-5(2)4-7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1
(3)InChIKey: RDIKFPRVLJLMER-BQBZGAKWBX