The Phosphonousdichloride, P,P'-(1,2-phenylene)bis-, with the CAS registry number 82495-67-8, is also known as 1,2-Bis(dichlorophosphino)benzene. This chemical's molecular formula is C₆H₄Cl₄P₂ and molecular weight is 279.86. What's more, its systematic name is benzene-1,2-diylbis(phosphonous dichloride).

Physical properties of Phosphonousdichloride, P,P'-(1,2-phenylene)bis- are: (1)ACD/LogP: 6.95; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6.95; (4)ACD/LogD (pH 7.4): 6.95; (5)ACD/BCF (pH 5.5): 113312.27; (6)ACD/BCF (pH 7.4): 113312.27; (7)ACD/KOC (pH 5.5): 144354.23; (8)ACD/KOC (pH 7.4): 144354.23; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 27.18 Å²; (13)Flash Point: 147.5 °C; (14)Enthalpy of Vaporization: 53.96 kJ/mol; (15)Boiling Point: 320.3 °C at 760 mmHg; (16)Vapour Pressure: 0.000602 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: ClP(Cl)c1ccccc1P(Cl)Cl
(2)Std. InChI: InChI=1S/C6H4Cl4P2/c7-11(8)5-3-1-2-4-6(5)12(9)10/h1-4H
(3)Std. InChIKey: IGYHSFVSIYJSML-UHFFFAOYSA-N