The Ranimustine with the CAS number 58994-96-0 is also called Cymerine. The IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]urea. Its molecular formula is C₁₀H₁₈ClN₃O₇. This chemical belongs to the following classification codes: (1)Antineoplastic agents; (2)Drug / Therapeutic Agent; (3)Mutation data; (4)Reproductive Effect.

The properties of the Ranimustine are: (1)ACD/LogP: 0.58; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 0.58; (4)ACD/LogD (pH 7.4): 0.58; (5)ACD/BCF (pH 5.5): 1.62; (6)ACD/BCF (pH 7.4): 1.62; (7)ACD/KOC (pH 5.5): 49.26; (8)ACD/KOC (pH 7.4): 49.18; (9)#H bond acceptors: 10; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 9; (12)Polar Surface Area: 99.13 Å²; (13)Index of Refraction: 1.616; (14)Molar Refractivity: 67.59 cm³; (15)Molar Volume: 193.2 cm³; (16)Polarizability: 26.79×10^-24cm³; (17)Surface Tension: 64.3 dyne/cm.

You can still convert the following datas into molecular structure:
(1)SMILES: ClCCN(N=O)C(=O)NC[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O
(2)InChI: InChI=1/C10H18ClN3O7/c1-20-9-8(17)7(16)6(15)5(21-9)4-12-10(18)14(13-19)3-2-11/h5-9,15-17H,2-4H2,1H3,(H,12,18)/t5-,6-,7+,8-,9+/m1/s1
(3)InChIKey: AHHFEZNOXOZZQA-ZEBDFXRSBU

The toxicity data is as follows: