The Cyclohexanone,5-methyl-2-(1-methylethyl)-, (2R,5S)- with CAS registry number of 3391-87-5 is also known as (+)-Menthone. The IUPAC name is (2R,5S)-5-Methyl-2-(propan-2-yl)cyclohexanone. Its EINECS registry number is 222-227-6. In addition, the formula is C₁₀H₁₈O and the molecular weight is 154.25. What's more, the storage temperature is 2-8 °C.

Physical properties about Cyclohexanone,5-methyl-2-(1-methylethyl)-, (2R,5S)- are: (1)ACD/LogP: 2.63; (2)#H bond acceptors: 1; (3)#Freely Rotating Bonds: 1; (4)Index of Refraction: 1.442; (5)Molar Refractivity: 46.37 cm³; (6)Molar Volume: 175 cm³; (7)Surface Tension: 27.2 dyne/cm; (8)Density: 0.881 g/cm³; (9)Flash Point: 72.8 °C; (10)Enthalpy of Vaporization: 44.12 kJ/mol; (11)Boiling Point: 205 °C at 760 mmHg; (12)Vapour Pressure: 0.256 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: CC1CCC(C(=O)C1)C(C)C
2. Isomeric SMILES: C[C@H]1CC[C@@H](C(=O)C1)C(C)C
3. InChI: InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1
4. InChIKey: NFLGAXVYCFJBMK-DTWKUNHWSA-N