The (E)-4-(4-Bromophenyl)-4-oxo-but-2-enoic acid with CAS registry number of 20972-38-7 is also known as 3-(4-Bromobenzoyl)acrylic acid. The IUPAC name and product name are the same. In addition, the formula is C₁₀H₇BrO₃ and the molecular weight is 255.06. This chemical may cause inflammation to the skin or other mucous membranes.

Physical properties about (E)-4-(4-Bromophenyl)-4-oxo-but-2-enoic acid are: (1)ACD/LogP: 2.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.14; (4)ACD/LogD (pH 7.4): -1.11; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 2.3; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.609; (13)Molar Refractivity: 54.85 cm³; (14)Molar Volume: 158.4 cm³; (15)Surface Tension: 55 dyne/cm; (16)Density: 1.61 g/cm³; (17)Flash Point: 193.6 °C; (18)Enthalpy of Vaporization: 68.21 kJ/mol; (19)Boiling Point: 396.5 °C at 760 mmHg; (20)Vapour Pressure: 5.35E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. SMILES:O=C(c1ccc(Br)cc1)\C=C\C(=O)O
2. InChI:InChI=1/C10H7BrO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6H,(H,13,14)/b6-5+
3. InChIKey:CJNVLFPUEBQQMZ-AATRIKPKBX
4. Std. InChI:InChI=1S/C10H7BrO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6H,(H,13,14)/b6-5+
5. Std. InChIKey:CJNVLFPUEBQQMZ-AATRIKPKSA-N