The 1-Methoxy-5-methylphenazinium methyl sulfate with CAS registry number of 65162-13-2 is also known as Phenazinium, 1-methoxy-5-methyl-, methyl sulfate. The IUPAC name is 1-Methoxy-5-methylphenazin-5-ium; methyl sulfate. Its EINECS registry number is 265-579-6. In addition, the formula is C₁₄H₁₃N₂O^.CH₃O₄S and the molecular weight is 336.36. This chemical is a red crystal or powder that should be sealed in cool, dry place away from oxidants. What's more, it may cause damage to health.

Physical properties about 1-Methoxy-5-methylphenazinium methyl sulfate are: (1)H-Bond Acceptor: 6; (2)Rotatable Bond Count: 1; (3)Exact Mass: 336.077992; (4)MonoIsotopic Mass: 336.077992; (5)Topological Polar Surface Area: 101; (6)Heavy Atom Count: 23; (7)Complexity: 362; (8)Covalently-Bonded Unit Count: 2.

When you are using this chemical, please be cautious about it. As a chemical, it is irritating to eyes, skin and harmful if swallowed. However, there is limited evidence of a carcinogenic effect. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.

You can still convert the following datas into molecular structure:
1. SMILES: [O-]S(=O)(=O)OC.O(c2cccc1[n+](c3c(nc12)cccc3)C)C
2. InChI: InChI=1/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1
3. InChIKey: MASUWVVNWALEEM-REWHXWOFAZ
4. Std. InChI: InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1
5. Std. InChIKey: MASUWVVNWALEEM-UHFFFAOYSA-M