The 1-Morpholinocyclododecene with the cas number 3725-39-1 is also called Morpholine,4-(1-cyclododecen-1-yl)-. The systematic name is 4-cyclododec-1-en-1-ylmorpholine. Its EINECS registry number is 223-080-0. The molecular formula is C₁₆H₂₉NO. This chemical can be stored at 2-8°C.

The properties of the chemical are: (1)ACD/LogP: 5.87; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 12.47 Å²; (7)Index of Refraction: 1.486; (8)Molar Refractivity: 76.6 cm³; (9)Molar Volume: 266.3 cm³; (10)Polarizability: 30.36×10^-24cm³; (11)Surface Tension: 33.8 dyne/cm; (12)Enthalpy of Vaporization: 62.84 kJ/mol; (13)Vapour Pressure: 5.51×10^-6 mmHg at 25°C.

Uses: This chemical can react with dimethyl-succinimido-sulfonium; chloride to product 3-Chlor-2-morpholino-1-cyclododecen. This reaction needs reagent CH₂Cl₂. The yield is 79%. This reaction has other conditions: (1)-20 deg C; (2)20 deg C, 48 h.

You can still convert the following datas into molecular structure:
(1)SMILES: O2CCN(/C1=C/CCCCCCCCCC1)CC2
(2)InChI: InChI=1/C16H29NO/c1-2-4-6-8-10-16(11-9-7-5-3-1)17-12-14-18-15-13-17/h10H,1-9,11-15H2/b16-10+
(3)InChIKey: SZTBSJOMNRSBGA-MHWRWJLKBX