The 1H-Benzimidazole,2-bromo-5,6-dichloro-, with the CAS registry number 142356-40-9, is also known as 5,6-Dichloro-2-bromobenzimidazole. This chemical's molecular formula is C₇H₃BrCl₂N₂ and molecular weight is 265.9221. Its systematic name is called 2-bromo-5,6-dichloro-1H-benzimidazole.

Physical properties of 1H-Benzimidazole,2-bromo-5,6-dichloro-: (1)ACD/LogP: 3.82; (2)ACD/LogD (pH 5.5): 3.75; (3)ACD/LogD (pH 7.4): 2.75; (4)ACD/BCF (pH 5.5): 406.47; (5)ACD/BCF (pH 7.4): 40.27; (6)ACD/KOC (pH 5.5): 2465.86; (7)ACD/KOC (pH 7.4): 244.32; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)Index of Refraction: 1.732; (11)Molar Refractivity: 54.1 cm³; (12)Molar Volume: 135.1 cm³; (13)Surface Tension: 67.2 dyne/cm; (14)Density: 1.967 g/cm³; (15)Flash Point: 204.7 °C; (16)Enthalpy of Vaporization: 66.78 kJ/mol; (17)Boiling Point: 414.8 °C at 760 mmHg; (18)Vapour Pressure: 4.33E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc2nc(Br)nc2cc1Cl
(2)InChI: InChI=1/C7H3BrCl2N2/c8-7-11-5-1-3(9)4(10)2-6(5)12-7/h1-2H,(H,11,12)
(3)InChIKey: KEZMBKQTCPNSOF-UHFFFAOYAF