The 1H-Indole,6-(2-thienyl)-, with the CAS registry number 243972-30-7, is also known as 6-(2-Thienyl)-1H-indole. This chemical's molecular formula is C₁₂H₉NS and molecular weight is 199.27156. Its IUPAC name is called 6-thiophen-2-yl-1H-indole.

Physical properties of 1H-Indole,6-(2-thienyl)-: (1)ACD/LogP: 4.31; (2)ACD/LogD (pH 5.5): 4; (3)ACD/LogD (pH 7.4): 4; (4)ACD/BCF (pH 5.5): 385; (5)ACD/BCF (pH 7.4): 385; (6)ACD/KOC (pH 5.5): 2468; (7)ACD/KOC (pH 7.4): 2468; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.715; (12)Molar Refractivity: 61.505 cm³; (13)Molar Volume: 156.636 cm³; (14)Surface Tension: 55.345 dyne/cm; (15)Density: 1.272 g/cm³; (16)Flash Point: 190.268 °C; (17)Enthalpy of Vaporization: 61.857 kJ/mol; (18)Boiling Point: 393.769 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CSC(=C1)C2=CC3=C(C=C2)C=CN3
(2)InChI: InChI=1S/C12H9NS/c1-2-12(14-7-1)10-4-3-9-5-6-13-11(9)8-10/h1-8,13H
(3)InChIKey: KIHGQIOEKNMYHK-UHFFFAOYSA-N