The 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-3-fluoro-, its CAS registry number is 1111637-68-3, This chemical's molecular formula is C₇H₄BrFN₂ and molecular weight is 215.0225. What's more, its systematic name is called 5-Bromo-3-fluoro-1H-pyrrolo[2,3-b]pyridine.

Physical properties about 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-3-fluoro- are: (1)ACD/LogP: 0.84; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.84; (4)ACD/LogD (pH 7.4): 0.84; (5)ACD/BCF (pH 5.5): 2.562; (6)ACD/BCF (pH 7.4): 2.563; (7)ACD/KOC (pH 5.5): 68.25; (8)ACD/KOC (pH 7.4): 68.26; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 28.68 Å²; (13)Index of Refraction: 1.693; (14)Molar Refractivity: 44.304 cm³; (15)Molar Volume: 115.49 cm³; (16)Polarizability: 17.563×10^-24 cm³; (17)Surface Tension: 60.79 dyne/cm; (18)Density: 1.862 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: c1c(cnc2c1c(c[nH]2)F)Br
(2) InChI: InChI=1/C7H4BrFN2/c8-4-1-5-6(9)3-11-7(5)10-2-4/h1-3H,(H,10,11)
(3) InChIKey: FEEYLWOKLCNDQR-UHFFFAOYAV