The CAS register number of 2-(3-Ethylureido)-2-oxoacetic acid is 105919-00-4. It also can be called as Acetic acid,2-[[(ethylamino)carbonyl]amino]-2-oxo- and the systematic name about this chemical is [(ethylcarbamoyl)amino](oxo)acetic acid.

Physical properties about 2-(3-Ethylureido)-2-oxoacetic acid are: (1)ACD/LogP: -1.28; (2)ACD/LogD (pH 5.5): -5.02; (3)ACD/LogD (pH 7.4): -5.02; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 6; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 66.92Ų; (12)Index of Refraction: 1.49; (13)Molar Refractivity: 34.02 cm³; (14)Molar Volume: 117.5 cm³; (15)Polarizability: 13.48x10^-24cm³; (16)Surface Tension: 54.1 dyne/cm.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(C(=O)O)NC(=O)NCC
(2)InChI: InChI=1/C5H8N2O4/c1-2-6-5(11)7-3(8)4(9)10/h2H2,1H3,(H,9,10)(H2,6,7,8,11)
(3)InChIKey: LIPYGGZRJRZBSL-UHFFFAOYAU
(4)Std. InChI: InChI=1S/C5H8N2O4/c1-2-6-5(11)7-3(8)4(9)10/h2H2,1H3,(H,9,10)(H2,6,7,8,11)
(5)Std. InChIKey: LIPYGGZRJRZBSL-UHFFFAOYSA-N