The 2,2-Dimethylcyclopropyl cyanide, with the CAS registry number 5722-11-2, is also known as 1-Cyano-2,2-dimethylcyclopropane. This chemical's molecular formula is C₆H₉N and formula weight is 95.14. What's more, its IUPAC name and systematic name are the same which is called 2,2-dimethylcyclopropane-1-carbonitrile.

Physical properties of 2,2-Dimethylcyclopropyl cyanide: (1)ACD/LogP: 0.95; (2)#H bond acceptors: 1; (3)#H bond donors: 0; (4)#Freely Rotating Bonds: 0; (5)Polar Surface Area: 23.79 Å²; (6)Index of Refraction: 1.447; (7)Molar Refractivity: 27.7 cm³; (8)Molar Volume: 103.6 cm³; (9)Surface Tension: 30.8 dyne/cm; (10)Density: 0.91 g/cm³; (11)Flash Point: 35.7 °C; (12)Enthalpy of Vaporization: 37.82 kJ/mol; (13)Boiling Point: 140.9 °C at 760 mmHg; (14)Vapour Pressure: 5.99 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1(CC1C#N)C
(2)InChI: InChI=1S/C6H9N/c1-6(2)3-5(6)4-7/h5H,3H2,1-2H3
(3)InChIKey: CZPCJHBAFHCDRE-UHFFFAOYSA-N