The 2,3-Pyridinediamine,4-methyl-, with the CAS registry number 53929-59-2, is also known as NSC249323. This chemical's molecular formula is C₆H₉N₃ and molecular weight is 123.079647. Its IUPAC name is called 4-methylpyridine-2,3-diamine.

Physical properties of 2,3-Pyridinediamine,4-methyl-: (1)ACD/LogP: 0.73; (2)ACD/LogD (pH 7.4): 0.66; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1.81; (5)ACD/KOC (pH 5.5): 4.25; (6)ACD/KOC (pH 7.4): 50.81; (7)#H bond acceptors: 3; (8)#H bond donors: 4; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.647; (11)Molar Refractivity: 37.64 cm³; (12)Molar Volume: 103.4 cm³; (13)Surface Tension: 62.2 dyne/cm; (14)Density: 1.19 g/cm³; (15)Flash Point: 171.9 °C; (16)Enthalpy of Vaporization: 55.92 kJ/mol; (17)Boiling Point: 317.8 °C at 760 mmHg; (18)Vapour Pressure: 0.000377 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=C(C(=NC=C1)N)N
(2)InChI: InChI=1S/C6H9N3/c1-4-2-3-9-6(8)5(4)7/h2-3H,7H2,1H3,(H2,8,9)
(3)InChIKey: RWGGFJXJRPCCGD-UHFFFAOYSA-N