The 2,4(1H,3H)-Pyrimidinedione,6-fluoro-5-methyl-, with the CAS registry number 31458-36-3, is also known as 6-Fluorothymine. It belongs to the product categories of Pyrimidine; Miscellaneous Biochemicals. This chemical's molecular formula is C₅H₅FN₂O₂ and molecular weight is 144.1038. Its systematic name is called 6-fluoro-5-methylpyrimidine-2,4(1H,3H)-dione.

Physical properties of 2,4(1H,3H)-Pyrimidinedione,6-fluoro-5-methyl-: (1)ACD/LogP: -0.19; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 17.89; (5)ACD/KOC (pH 7.4): 3.81; (6)#H bond acceptors: 4; (7)#H bond donors: 2; (8)Index of Refraction: 1.511; (9)Molar Refractivity: 30.25 cm³; (10)Molar Volume: 100.9 cm³; (11)Surface Tension: 41.7 dyne/cm; (12)Density: 1.42 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: F\C1=C(\C(=O)NC(=O)N1)C
(2)InChI: InChI=1/C5H5FN2O2/c1-2-3(6)7-5(10)8-4(2)9/h1H3,(H2,7,8,9,10)
(3)InChIKey: YDRTVDABIUUNKS-UHFFFAOYAC