This product is an organic compound with the formula C₄H₂Cl₂N₂. The IUPAC name of this chemical is 2,5-dichloropyrazine. With the CAS registry number 19745-07-4, it is also named as Pyrazine, 2,5-dichloro-. The product's categories are Piperazine Series; Pyrazines; Pyrazine; Building Blocks. In addition, the molecular weight is 148.9781.

The other characteristics of 2,5-Dichloropyrazine can be summarized as: (1)ACD/LogP: 1.49; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 25.78 Å²; (7)Index of Refraction: 1.559; (8)Molar Refractivity: 32.22 cm³; (9)Molar Volume: 99.7 cm³; (10)Polarizability: 12.77×10^-24 cm³; (11)Surface Tension: 51.5 dyne/cm; (12)Enthalpy of Vaporization: 40.34 kJ/mol; (13)Vapour Pressure: 1 mmHg at 25°C; (14)Exact Mass: 147.959503; (15)MonoIsotopic Mass: 147.959503; (16)Topological Polar Surface Area: 25.8; (17)Heavy Atom Count: 8; (18)Complexity: 68.4.

People can use the following data to convert to the molecule structure. 
1. SMILES:Clc1ncc(Cl)nc1
2. InChI:InChI=1/C4H2Cl2N2/c5-3-1-7-4(6)2-8-3/h1-2H
3. InChIKey:JVSDZAGCHKCSGR-UHFFFAOYAN
4. Std. InChI:InChI=1S/C4H2Cl2N2/c5-3-1-7-4(6)2-8-3/h1-2H
5. Std. InChIKey:JVSDZAGCHKCSGR-UHFFFAOYSA-N