The 2,5-Dimethylhexene, with the CAS registry number 26266-69-3, is also known as AC1O5H3R. This chemical's molecular formula is C₂₄H₄₈ and molecular weight is 336.6379. Its IUPAC name is called 2,5-dimethylhex-1-ene; 2,5-dimethylhex-2-ene; (E)-2,5-dimethylhex-3-ene.

Physical properties of 2,5-Dimethylhexene: (1)ACD/LogP: 4.33; (2)ACD/LogD (pH 5.5): 4.32; (3)ACD/LogD (pH 7.4): 4.32; (4)ACD/BCF (pH 5.5): 1140.1; (5)ACD/BCF (pH 7.4): 1140.1; (6)ACD/KOC (pH 5.5): 5367.33; (7)ACD/KOC (pH 7.4): 5367.33; (8)#Freely Rotating Bonds: 2; (9)Flash Point: 6.1 °C; (10)Enthalpy of Vaporization: 33.82 kJ/mol; (11)Boiling Point: 114.3 °C at 760 mmHg; (12)Vapour Pressure: 23.7 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(C)CCC(=C)C.CC(C)CC=C(C)C.CC(C)C=CC(C)C
(2)Isomeric SMILES: CC(C)CCC(=C)C.CC(C)CC=C(C)C.CC(C)/C=C/C(C)C
(3)InChI: InChI=1S/3C8H16/c3*1-7(2)5-6-8(3)4/h5,8H,6H2,1-4H3;5-8H,1-4H3;8H,1,5-6H2,2-4H3/b;6-5+
(4)InChIKey: DJDLBMVKJOTHRT-AUNBPGBOSA-N