The 2,6-Dibromo-4-nitropyridine N-oxide is an organic compound with the formula C₅H₂Br₂N₂O₃. The IUPAC name of this chemical is 2,6-dibromo-1-hydroxy-4-nitropyridin-1-ium. With the CAS registry number 98027-81-7, it is also named as pyridine, 2,6-dibromo-4-nitro-, 1-oxide.

The other characteristics of 2,6-Dibromo-4-nitropyridine N-oxide can be summarized as: (1)ACD/LogP: 0.55; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.55; (4)ACD/LogD (pH 7.4): 0.55; (5)ACD/BCF (pH 5.5): 1.55; (6)ACD/BCF (pH 7.4): 1.55; (7)ACD/KOC (pH 5.5): 47.62; (8)ACD/KOC (pH 7.4): 47.62; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.72; (13)Molar Refractivity: 48.61 cm³; (14)Molar Volume: 123 cm³; (15)Polarizability: 19.27×10^-24 cm³; (16)Surface Tension: 77.3 dyne/cm; (17)Enthalpy of Vaporization: 68.86 kJ/mol; (18)Vapour Pressure: 4.49E-08 mmHg at 25°C; (19)Exact Mass: 298.848996; (20)MonoIsotopic Mass: 296.851042; (21)Topological Polar Surface Area: 69.9; (22)Heavy Atom Count: 12; (23)Formal Charge: 1; (24)Complexity: 174.

People can use the following data to convert to the molecule structure.
1. SMILES:c1c(cc([n+](c1Br)[O-])Br)[N+](=O)[O-]
2. InChI:InChI=1/C5H2Br2N2O3/c6-4-1-3(9(11)12)2-5(7)8(4)10/h1-2H
3. InChIKey:MJEDSUKRJRIBKE-UHFFFAOYAL
4. Std. InChI:InChI=1S/C5H2Br2N2O3/c6-4-1-3(9(11)12)2-5(7)8(4)10/h1-2H 
5. Std. InChIKey:MJEDSUKRJRIBKE-UHFFFAOYSA-N