The Cyclobutanone, 2-chloro- with CAS registry number of 20686-67-3 is also known as 2-Chlorocyclobutanone. The IUPAC name is 2-Chlorocyclobutan-1-one. In addition, the formula is C₄H₅ClO and the molecular weight is 104.53.

Physical properties about Cyclobutanone, 2-chloro- are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 14.16; (4)ACD/KOC (pH 7.4): 14.16; (5)#H bond acceptors: 1; (6)Index of Refraction: 1.464; (7)Molar Refractivity: 23.44 cm³; (8)Molar Volume: 84.8 cm³; (9)Surface Tension: 32.4 dyne/cm; (10)Density: 1.23 g/cm³; (11)Flash Point: 51.4 °C; (12)Enthalpy of Vaporization: 41.22 kJ/mol; (13)Boiling Point: 175.9 °C at 760 mmHg; (14)Vapour Pressure: 1.12 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1CC(=O)C1Cl
2. InChI: InChI=1S/C4H5ClO/c5-3-1-2-4(3)6/h3H,1-2H2
3. InChIKey: CGHOAAYJDWPGRG-UHFFFAOYSA-N