The 2-Hydroxy-4-amino butanoic acid with the CAS number 13477-53-7 is also called Butanoic acid,4-amino-2-hydroxy-. Both the systematic name and IUPAC name are 4-amino-2-hydroxybutanoic acid. Its molecular formula is C₄H₉NO₃. This chemical belongs to the following product categories: (1)Alcohols and Derivatives; (2)Amino Acids and Derivatives; (3)(intermediate of amikacin sulfate).

The properties of the 2-Hydroxy-4-amino butanoic acid are: (1)ACD/LogP: -1.10; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.6; (4)ACD/LogD (pH 7.4): -3.6; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 38.77 Å²; (13)Index of Refraction: 1.51; (14)Molar Refractivity: 27.17 cm³; (15)Molar Volume: 90.7 cm³; (16)Polarizability: 10.77×10^-24cm³; (17)Surface Tension: 63.5 dyne/cm; (18)Enthalpy of Vaporization: 70.33 kJ/mol; (19)Vapour Pressure: 1.08×10^-6 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C(O)CCN
(2)InChI: InChI=1/C4H9NO3/c5-2-1-3(6)4(7)8/h3,6H,1-2,5H2,(H,7,8)
(3)InChIKey: IVUOMFWNDGNLBJ-UHFFFAOYAP

The toxicity data is as follows: