The 2-Pyrazinamine,6-chloro-N-cyclopropyl-, with the CAS registry number 941294-47-9, is also known as 2-Chloro-6-cyclopropylaminopyrazine. It belongs to the product categories of Amines; Blocks. This chemical's molecular formula is C₇H₈ClN₃ and molecular weight is 169.6115. Its systematic name is called 6-chloro-N-cyclopropyl-pyrazin-2-amine.

Physical properties of 2-Pyrazinamine,6-chloro-N-cyclopropyl-: (1)ACD/LogP: 1.70; (2)ACD/LogD (pH 5.5): 1.701; (3)ACD/LogD (pH 7.4): 1.701; (4)ACD/BCF (pH 5.5): 11.561; (5)ACD/BCF (pH 7.4): 11.561; (6)ACD/KOC (pH 5.5): 200.68; (7)ACD/KOC (pH 7.4): 200.688; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.682; (12)Molar Refractivity: 44.14 cm³; (13)Molar Volume: 116.578 cm³; (14)Surface Tension: 70.384 dyne/cm; (15)Density: 1.455 g/cm³; (16)Flash Point: 135.382 °C; (17)Enthalpy of Vaporization: 54.029 kJ/mol; (18)Boiling Point: 300.242 °C at 760 mmHg; (19)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1c(nc(cn1)Cl)NC2CC2
(2)InChI: InChI=1/C7H8ClN3/c8-6-3-9-4-7(11-6)10-5-1-2-5/h3-5H,1-2H2,(H,10,11)
(3)InChIKey: TYAIEHCRGITGEM-UHFFFAOYAV