The 2-Pyrazinamine,6-chloro-N-propyl-, with the CAS registry number 951884-52-9, is also known as 2-Chloro-6-(propylamino)pyrazine. It belongs to the product categories of Amines; Blocks. This chemical's molecular formula is C₇H₁₀ClN₃ and molecular weight is 171.6274. Its systematic name is called 6-chloro-N-propyl-pyrazin-2-amine.

Physical properties of 2-Pyrazinamine,6-chloro-N-propyl-: (1)ACD/LogP: 2.11; (2)ACD/LogD (pH 5.5): 2.11; (3)ACD/LogD (pH 7.4): 2.11; (4)#H bond acceptors: 3; (5)#H bond donors: 1; (6)#Freely Rotating Bonds: 2; (7)Index of Refraction: 1.572; (8)Molar Refractivity: 46.2 cm³; (9)Molar Volume: 140.3 cm³; (10)Surface Tension: 48.3 dyne/cm; (11)Density: 1.223 g/cm³; (12)Flash Point: 122 °C; (13)Enthalpy of Vaporization: 51.67 kJ/mol; (14)Boiling Point: 278.1 °C at 760 mmHg; (15)Vapour Pressure: 0.00435 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CCCNc1cncc(n1)Cl
(2)InChI: InChI=1/C7H10ClN3/c1-2-3-10-7-5-9-4-6(8)11-7/h4-5H,2-3H2,1H3,(H,10,11)
(3)InChIKey: FTDDBUCCKNVIJZ-UHFFFAOYAY