The 2-Quinoxalineaceticacid, 3-chloro-a-cyano-,methyl ester, with the CAS registry number 10176-23-5, has the molecular formula C₁₂H₈ClN₃O₂, and its formula weight is 261.6638. What's more, its systematic name is called methyl (3-chloroquinoxalin-2-yl)(cyano)acetate .

Physical properties of 2-Quinoxalineaceticacid, 3-chloro-a-cyano-,methyl ester: (1)ACD/LogP: 0.78; (2)#H bond acceptors: 5; (3)#H bond donors: 0; (4)#Freely Rotating Bonds: 3; (5)Index of Refraction: 1.627; (6)Molar Refractivity: 65.679 cm³; (7)Molar Volume: 185.392 cm³; (8)Surface Tension: 63.395 dyne/cm; (9)Density: 1.411 g/cm³; (10)Flash Point: 193.711 °C; (11)Enthalpy of Vaporization: 64.702 kJ/mol; (12)Boiling Point: 396.689 °C at 760 mmHg; (13)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: COC(=O)C(C#N)c1nc2ccccc2nc1Cl
(2)InChI: InChI=1/C12H8ClN3O2/c1-18-12(17)7(6-14)10-11(13)16-9-5-3-2-4-8(9)15-10/h2-5,7H,1H3
(3)InChIKey: YGDTUUXGELOIDG-UHFFFAOYAE