The 3-(N-Ethyl-N-benzyl)aminoacetanilide with the cas number 29103-58-0 is also called Acetamide,N-[3-[ethyl(phenylmethyl)amino]phenyl]-. Both the systematic name and IUPAC name N-[3-[benzyl(ethyl)amino]phenyl]acetamide. Its EINECS registry number is 249-436-5. The molecular formula is C₁₇H₂₀N₂O.
 

The properties of the chemical are: (1)ACD/LogP: 3.71; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.63; (4)ACD/LogD (pH 7.4): 3.71; (5)ACD/BCF (pH 5.5): 320.83; (6)ACD/BCF (pH 7.4): 389.63; (7)ACD/KOC (pH 5.5): 2047.72; (8)ACD/KOC (pH 7.4): 2486.91; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 23.55 Å²; (13)Index of Refraction: 1.624; (14)Molar Refractivity: 83.95 cm³; (15)Molar Volume: 237.7 cm³; (16)Polarizability: 33.28×10^-24cm³; (17)Surface Tension: 47.7 dyne/cm; (18)Enthalpy of Vaporization: 74.93 kJ/mol ; (19)Vapour Pressure: 1.58×10^-9 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(Nc2cccc(N(CC)Cc1ccccc1)c2)C
(2)InChI: InChI=1/C17H20N2O/c1-3-19(13-15-8-5-4-6-9-15)17-11-7-10-16(12-17)18-14(2)20/h4-12H,3,13H2,1-2H3,(H,18,20)
(3)InChIKey: WHILCEOUZRONTD-UHFFFAOYAG