The 2-Hydroxy-3-brom-pyrazolo[1,5-a]pyridin, with the CAS registry number of 60637-30-1, is also known as 3-Bromopyrazolo[1,5-a]pyridin-2(1H)-one. Its molecular formula is C₇H₅BrN₂O and molecular weight is 213.0314. What's more, its systematic name is 3-Bromopyrazolo[1,5-a]pyridin-2-ol.

Physical properties about the 2-Hydroxy-3-brom-pyrazolo[1,5-a]pyridin are: (1)ACD/LogP: 1.99; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 0; (10)Polar Surface Area: 37.53 Å²; (11)Index of Refraction: 1.727; (12)Molar Refractivity: 45.122 cm³; (13)Molar Volume: 113.44 cm³; (14)Surface Tension: 61.84 dyne/cm; (15)Density: 1.878 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: c1ccn2c(c1)c(c(n2)O)Br
(2) InChI: InChI=1/C7H5BrN2O/c8-6-5-3-1-2-4-10(5)9-7(6)11/h1-4H,(H,9,11)
(3) InChIKey: UVTOQVBDNLWPLP-UHFFFAOYAP