The 2H-3, 1-Benzoxazine-2, 4(1H)-dione, 8-methoxy-, with the CAS registry number of 34954-65-9, is also known as 3-Methoxy-isatoic anhydride and 3-Methoxyisatoicanhydride. This chemical's molecular formula is C₉H₇NO₄ and molecular weight is 193.16. What's more, its systematic name is called 8-Methoxy-2H-3, 1-benzoxazine-2, 4(1H)-dione.

Physical properties about 2H-3, 1-Benzoxazine-2, 4(1H)-dione, 8-methoxy- are: (1)ACD/LogP: 1.37; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.36; (4)ACD/LogD (pH 7.4): 1.36; (5)ACD/BCF (pH 5.5): 6.41; (6)ACD/BCF (pH 7.4): 6.41; (7)ACD/KOC (pH 5.5): 131.65; (8)ACD/KOC (pH 7.4): 131.62; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 46.61 Ų; (13)Index of Refraction: 1.575; (14)Molar Refractivity: 43.85 cm³; (15)Molar Volume: 132.6 cm³; (16)Polarizability: 17.38×10^-24 cm³; (17)Surface Tension: 48.3 dyne/cm; (18)Density: 1.335 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C2OC(=O)Nc1c2cccc1C
(2) InChI: InChI=1/C9H7NO3/c1-5-3-2-4-6-7(5)10-9(12)13-8(6)11/h2-4H,1H3,(H,10,12)
(3) InChIKey: CHKUQVBJPDLANA-UHFFFAOYAH