The 3-Methylbenzofuran-2-carbohydrazide, with the CAS registry number 53524-81-5, is also known as 2-Benzofurancarboxylic acid, 3-methyl-, hydrazide. This chemical's molecular formula is C₁₀H₁₀N₂O₂ and molecular weight is 190.1986. What's more, both its IUPAC name and systematic name are the same which is called 3-Methyl-1-benzofuran-2-carbohydrazide.

Physical properties about 3-Methylbenzofuran-2-carbohydrazide are: (1)ACD/LogP: 1.16; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.79; (4)ACD/LogD (pH 7.4): 0.79; (5)ACD/BCF (pH 5.5): 2.34; (6)ACD/BCF (pH 7.4): 2.34; (7)ACD/KOC (pH 5.5): 63.93; (8)ACD/KOC (pH 7.4): 64.04; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 36.69 Å²; (13)Index of Refraction: 1.634; (14)Molar Refractivity: 53.74 cm³; (15)Molar Volume: 150.1 cm³; (16)Surface Tension: 53 dyne/cm; (17)Density: 1.266 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(c2oc1ccccc1c2C)NN
(2) InChI: InChI=1/C10H10N2O2/c1-6-7-4-2-3-5-8(7)14-9(6)10(13)12-11/h2-5H,11H2,1H3,(H,12,13)
(3) InChIKey: SNUIRFLZLMGGLO-UHFFFAOYAI