This chemical's CAS registry number is 19585-90-1 and it also known as 2,4-Quinolinedicarboxylic acid, 3-phenyl-. This chemical's molecular formula is C₁₇H₁₁NO₄ and molecular weight is 293.2735. What's more, both the product name and systematic name are the same which is called 3-Phenylquinoline-2,4-dicarboxylic acid.

Physical properties about 3-Phenylquinoline-2,4-dicarboxylic acid are: (1)ACD/LogP: 1.86; (2)#of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 5; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 65.49 Å²; (11)Index of Refraction: 1.706; (12)Molar Refractivity: 80.63 cm³; (13)Molar Volume: 207.1 cm³; (14)Polarizability: 31.96×10^-24 cm³; (15)Surface Tension: 71.7 dyne/cm; (16)Density: 1.415 g/cm³; (17)Flash Point: 226.2 °C; (18)Enthalpy of Vaporization: 74.74 kJ/mol; (19)Boiling Point: 450.4 °C at 760 mmHg; (20)Vapour Pressure: 6.73E-09 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(O)c1c3ccccc3nc(c1c2ccccc2)C(=O)O
(2) InChI: InChI=1/C17H11NO4/c19-16(20)14-11-8-4-5-9-12(11)18-15(17(21)22)13(14)10-6-2-1-3-7-10/h1-9H,(H,19,20)(H,21,22)
(3) InChIKey: BEJHKUKBANBLMR-UHFFFAOYAL